| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:03:28 UTC |
|---|
| Update Date | 2025-03-21 18:28:13 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00070452 |
|---|
| Frequency | 42.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H11NO5S |
|---|
| Molecular Mass | 269.0358 |
|---|
| SMILES | O=S(=O)(O)Oc1ccc(NCc2ccco2)cc1 |
|---|
| InChI Key | PMLMHKWXLVNRPB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | arylsulfates |
|---|
| Direct Parent | phenylsulfates |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | furansheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganooxygen compoundsorganopnictogen compoundsoxacyclic compoundsphenoxy compoundsphenylalkylaminessecondary alkylarylaminessulfuric acid monoesters |
|---|
| Substituents | furanmonocyclic benzene moietysulfuric acid monoesteraromatic heteromonocyclic compoundphenylsulfateorganic oxideorganonitrogen compoundorganopnictogen compoundorganoheterocyclic compoundheteroaromatic compoundsecondary aminesecondary aliphatic/aromatic amineoxacycleorganic oxygen compoundphenylalkylaminesulfate-esterhydrocarbon derivativebenzenoidorganic nitrogen compoundphenoxy compoundsulfuric acid esteramineorganooxygen compound |
|---|