| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:03:31 UTC |
|---|
| Update Date | 2025-03-21 18:28:14 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00070596 |
|---|
| Frequency | 42.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H18O3 |
|---|
| Molecular Mass | 222.1256 |
|---|
| SMILES | Oc1ccc(C(O)C2(O)CCCCC2)cc1 |
|---|
| InChI Key | WTLBEIDFOLWKLV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | cyclohexanols |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1,2-diols1-hydroxy-2-unsubstituted benzenoidsaromatic alcoholsbenzene and substituted derivativescyclic alcohols and derivativeshydrocarbon derivativestertiary alcohols |
|---|
| Substituents | aromatic alcoholmonocyclic benzene moietycyclohexanol1-hydroxy-2-unsubstituted benzenoidcyclic alcoholaromatic homomonocyclic compoundtertiary alcoholphenolhydrocarbon derivativebenzenoid1,2-diol |
|---|
