| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:03:32 UTC |
|---|
| Update Date | 2025-03-21 18:28:14 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00070601 |
|---|
| Frequency | 42.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H21NO6S |
|---|
| Molecular Mass | 379.109 |
|---|
| SMILES | COc1ccc2c3c1OC1C(OS(=O)(=O)O)C=CC4C(C2)N(C)CCC341 |
|---|
| InChI Key | JIYGLXDCNSTUSY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | alkaloids and derivatives |
|---|
| Class | morphinans |
|---|
| Subclass | morphinans |
|---|
| Direct Parent | morphinans |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersalkyl sulfatesanisolesazacyclic compoundscoumaranshydrocarbon derivativesorganic oxidesorganopnictogen compoundsoxacyclic compoundsphenanthrenes and derivativespiperidinessulfuric acid monoesterstetralinstrialkylamines |
|---|
| Substituents | tetralinphenol ethersulfuric acid monoesteretheralkyl aryl etherorganic oxidearomatic heteropolycyclic compoundalkyl sulfateorganonitrogen compoundorganopnictogen compoundpiperidinetertiary amineorganoheterocyclic compoundcoumaranphenanthreneorganic sulfuric acid or derivativesazacycletertiary aliphatic amineoxacycleorganic oxygen compoundanisolesulfate-esterhydrocarbon derivativebenzenoidorganic nitrogen compoundsulfuric acid estermorphinanamineorganooxygen compound |
|---|