| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:03:36 UTC |
|---|
| Update Date | 2025-03-21 18:28:16 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00070786 |
|---|
| Frequency | 42.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H8O6S |
|---|
| Molecular Mass | 232.0042 |
|---|
| SMILES | Cc1cc(O)ccc1C(=O)OS(=O)(=O)O |
|---|
| InChI Key | LXFLNHNPHBLUTM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | benzoic acids and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsbenzoyl derivativeshydrocarbon derivativesmeta cresolsmonocarboxylic acids and derivativesorganic oxidesorganooxygen compoundssulfuric acid monoesterstoluenes |
|---|
| Substituents | sulfuric acid monoesterorganic sulfuric acid or derivativesm-cresolbenzoyl1-hydroxy-2-unsubstituted benzenoidbenzoic acid or derivativescarboxylic acid derivativearomatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundphenolhydrocarbon derivativesulfuric acid estertolueneorganooxygen compound |
|---|