| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:03:39 UTC |
|---|
| Update Date | 2025-03-21 18:28:17 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00070896 |
|---|
| Frequency | 42.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H7N5O3 |
|---|
| Molecular Mass | 221.0549 |
|---|
| SMILES | Cn1cc(C(=O)O)nc2c(=O)nc(N)nc1-2 |
|---|
| InChI Key | RTKWPYUFDOQFIN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pterins and derivatives |
|---|
| Direct Parent | pterin carboxylates |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | amino acidsazacyclic compoundscarboxylic acidsheteroaromatic compoundshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganooxygen compoundsorganopnictogen compoundsprimary aminespyrazine carboxylic acidspyrimidonesvinylogous amides |
|---|
| Substituents | carboxylic acidamino acid or derivativesamino acidpyrimidonecarboxylic acid derivativepyrimidineorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundvinylogous amideazacycleheteroaromatic compoundpterin-6-carboxylatemonocarboxylic acid or derivativesorganic oxygen compoundpyrazinepyrazine carboxylic acidpyrazine carboxylic acid or derivativeshydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|
