| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:03:40 UTC |
|---|
| Update Date | 2025-03-21 18:28:17 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00070939 |
|---|
| Frequency | 42.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C26H27NO2 |
|---|
| Molecular Mass | 385.2042 |
|---|
| SMILES | O=C(Cc1ccccc1)N1CCC(C(O)(c2ccccc2)c2ccccc2)CC1 |
|---|
| InChI Key | WRCGOXHXRADRKD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylmethanes |
|---|
| Direct Parent | diphenylmethanes |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | aromatic alcoholsazacyclic compoundscarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesn-acylpiperidinesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphenylacetamidestertiary alcoholstertiary carboxylic acid amides |
|---|
| Substituents | aromatic alcoholalcoholdiphenylmethanecarbonyl grouparomatic heteromonocyclic compoundazacyclecarboxamide groupcarboxylic acid derivativen-acyl-piperidinetertiary alcoholorganic oxideorganic oxygen compoundtertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundpiperidinephenylacetamideorganoheterocyclic compoundorganooxygen compound |
|---|
