| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:03:43 UTC |
|---|
| Update Date | 2025-03-21 18:28:18 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00071042 |
|---|
| Frequency | 42.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H24O4 |
|---|
| Molecular Mass | 244.1675 |
|---|
| SMILES | COC(=O)C(C)(C)C(OC(=O)C(C)C)C(C)C |
|---|
| InChI Key | HUKZTTIJXKOHGT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | fatty acyls |
|---|
| Subclass | fatty acid esters |
|---|
| Direct Parent | fatty acid esters |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | carbonyl compoundsdicarboxylic acids and derivativeshydrocarbon derivativesmethyl estersorganic oxides |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acid derivativefatty acid esterorganic oxidemethyl esterorganic oxygen compoundcarboxylic acid esterdicarboxylic acid or derivativeshydrocarbon derivativeorganooxygen compound |
|---|