| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:03:43 UTC |
|---|
| Update Date | 2025-03-21 18:28:19 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00071061 |
|---|
| Frequency | 42.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C20H18O10 |
|---|
| Molecular Mass | 418.09 |
|---|
| SMILES | O=C1CC(c2ccc(OC3OC(C(=O)O)C(O)C3O)cc2)Oc2cc(O)cc(O)c21 |
|---|
| InChI Key | PXCKAYYLVVORJV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | flavonoid glycosides |
|---|
| Direct Parent | flavonoid o-glycosides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diols1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids5-hydroxyflavonoids7-hydroxyflavonoidsacetalsalkyl aryl ethersaryl alkyl ketonesbeta hydroxy acids and derivativescarboxylic acidschromonesflavanoneshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesoxacyclic compoundsphenol ethersphenoxy compoundssecondary alcoholstetrahydrofuransvinylogous acids |
|---|
| Substituents | phenol ethermonocyclic benzene moietycarbonyl groupethercarboxylic acidaryl alkyl ketone1-benzopyranflavanoneflavan1-hydroxy-2-unsubstituted benzenoidmonosaccharidealkyl aryl ethercarboxylic acid derivativeketonebeta-hydroxy acidsaccharideorganic oxideacetalchromonearomatic heteropolycyclic compoundchromaneflavonoid-4p-o-glycosideorganoheterocyclic compound1,2-diolalcoholbenzopyrantetrahydrofuran5-hydroxyflavonoidhydroxy acid1-hydroxy-4-unsubstituted benzenoidflavonoid o-glycosideoxacyclevinylogous acidmonocarboxylic acid or derivativesorganic oxygen compound7-hydroxyflavonoidsecondary alcoholhydrocarbon derivativebenzenoidphenoxy compoundorganooxygen compoundaryl ketone |
|---|
