| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:03:47 UTC |
|---|
| Update Date | 2025-03-21 18:28:20 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00071192 |
|---|
| Frequency | 42.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C21H32O4 |
|---|
| Molecular Mass | 348.2301 |
|---|
| SMILES | CC(=O)OC1CCC2(C)C(CCC3C4CCC(=O)C4(C)CC(O)C32)C1 |
|---|
| InChI Key | CEFAOKKMPAXYIR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | steroids and steroid derivatives |
|---|
| Subclass | steroid esters |
|---|
| Direct Parent | steroid esters |
|---|
| Geometric Descriptor | aliphatic homopolycyclic compounds |
|---|
| Alternative Parents | 11-hydroxysteroids17-oxosteroidsandrostane steroidscarboxylic acid esterscyclic alcohols and derivativeshydrocarbon derivativesketonesmonocarboxylic acids and derivativesorganic oxidessecondary alcohols |
|---|
| Substituents | alcoholcarbonyl groupoxosteroidhydroxysteroidcyclic alcoholcarboxylic acid derivativesteroid esteraliphatic homopolycyclic compoundketoneorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundandrostane-skeletoncarboxylic acid estersecondary alcohol17-oxosteroidhydrocarbon derivative11-hydroxysteroidorganooxygen compound |
|---|
