| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-21 00:03:52 UTC |
|---|
| Update Date | 2025-03-21 18:28:22 UTC |
|---|
| HMDB ID | HMDB0240660 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00071417 |
|---|
| Name | 5-Bromotryptophan |
|---|
| Frequency | 42.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H11BrN2O2 |
|---|
| Molecular Mass | 282.0004 |
|---|
| SMILES | NC(Cc1c[nH]c2ccc(Br)cc12)C(=O)O |
|---|
| InChI Key | KZDNJQUJBMDHJW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | aryl bromidesazacyclic compoundsbenzenoidscarbonyl compoundscarboxylic acidsheteroaromatic compoundshydrocarbon derivativesindolesmonoalkylaminesmonocarboxylic acids and derivativesorganic oxidesorganobromidesorganonitrogen compoundsorganopnictogen compoundspyrroles |
|---|
| Substituents | carbonyl groupcarboxylic acidindoleorganohalogen compoundorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundorganoheterocyclic compoundazacycleheteroaromatic compoundindole or derivativesaryl halidemonocarboxylic acid or derivativesorganic oxygen compoundpyrroleorganobromidehydrocarbon derivativebenzenoidprimary aliphatic amineorganic nitrogen compoundaryl bromideorganooxygen compound |
|---|
