| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:03:53 UTC |
|---|
| Update Date | 2025-03-21 18:28:22 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00071462 |
|---|
| Frequency | 42.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H19NO3S |
|---|
| Molecular Mass | 245.1086 |
|---|
| SMILES | CCCN(CCC)S(=O)(=O)c1ccc(C)o1 |
|---|
| InChI Key | MJVMMTUCMADMSU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfonic acids and derivatives |
|---|
| Subclass | organosulfonic acids and derivatives |
|---|
| Direct Parent | organosulfonamides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | aminosulfonyl compoundsfuransheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundsoxacyclic compounds |
|---|
| Substituents | furanaromatic heteromonocyclic compoundaminosulfonyl compoundheteroaromatic compoundorganosulfur compoundorganosulfonic acid amideoxacycleorganic oxidesulfonylorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganoheterocyclic compoundorganooxygen compound |
|---|
