| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-21 00:03:57 UTC |
|---|
| Update Date | 2025-03-21 18:28:24 UTC |
|---|
| HMDB ID | HMDB0303826 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00071608 |
|---|
| Name | Protocatechuic acid 4-glucoside |
|---|
| Frequency | 41.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H16O9 |
|---|
| Molecular Mass | 316.0794 |
|---|
| SMILES | O=C(O)c1ccc(OC2OC(CO)C(O)C(O)C2O)c(O)c1 |
|---|
| InChI Key | HFFREILXLCWCQH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | hydroxybenzoic acid derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacetalsbenzoic acidsbenzoyl derivativescarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanesphenol ethersphenoxy compoundsprimary alcoholssecondary alcohols |
|---|
| Substituents | phenol ethercarboxylic acidaromatic heteromonocyclic compoundbenzoyl1-hydroxy-2-unsubstituted benzenoidmonosaccharidecarboxylic acid derivativesaccharideorganic oxideacetalbenzoic acidoxaneprimary alcoholorganoheterocyclic compoundalcohol1-hydroxy-4-unsubstituted benzenoidhydroxybenzoic acidoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholphenolhydrocarbon derivativephenoxy compoundorganooxygen compound |
|---|
