| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:03:58 UTC |
|---|
| Update Date | 2025-03-21 18:28:24 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00071635 |
|---|
| Frequency | 41.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C19H20O9 |
|---|
| Molecular Mass | 392.1107 |
|---|
| SMILES | O=C(CCc1ccc(O)cc1)c1c(O)cc(O)cc1OC1OC(O)C(O)C1O |
|---|
| InChI Key | HWKRWLYZYMXITE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | linear 1,3-diarylpropanoids |
|---|
| Subclass | chalcones and dihydrochalcones |
|---|
| Direct Parent | 2'-hydroxy-dihydrochalcones |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diols1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacetalsalkyl-phenylketonesaryl alkyl ketonesbenzoyl derivativesbutyrophenonescinnamylphenolshemiacetalshydrocarbon derivativesmonosaccharidesorganic oxidesoxacyclic compoundsphenol ethersphenoxy compoundsresorcinolssecondary alcoholstetrahydrofuransvinylogous acids |
|---|
| Substituents | phenol ethermonocyclic benzene moiety2'-hydroxy-dihydrochalconearyl alkyl ketonearomatic heteromonocyclic compoundbenzoyl1-hydroxy-2-unsubstituted benzenoidmonosaccharidecinnamylphenolresorcinolketonesaccharideorganic oxideacetalhemiacetalorganoheterocyclic compound1,2-diolalcoholtetrahydrofuran1-hydroxy-4-unsubstituted benzenoidphenylketonebutyrophenoneoxacyclevinylogous acidorganic oxygen compoundsecondary alcoholphenolhydrocarbon derivativebenzenoidphenoxy compoundalkyl-phenylketoneorganooxygen compoundaryl ketone |
|---|
