| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:03:59 UTC |
|---|
| Update Date | 2025-03-21 18:28:24 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00071697 |
|---|
| Frequency | 41.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H11N3O3 |
|---|
| Molecular Mass | 185.08 |
|---|
| SMILES | NC(=O)C(N)C(=O)C1CCC(O)=N1 |
|---|
| InChI Key | WFYSXSIODNNLIP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acids |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,3-dicarbonyl compoundsazacyclic compoundscarboxylic acids and derivativescyclic carboximidic acidsfatty amideshydrocarbon derivativesketonesmonoalkylaminesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsprimary carboxylic acid amidespropargyl-type 1,3-dipolar organic compoundspyrrolines |
|---|
| Substituents | primary carboxylic acid amidefatty acylcarbonyl groupfatty amidepropargyl-type 1,3-dipolar organic compoundketoneorganic oxidealiphatic heteromonocyclic compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundorganoheterocyclic compoundazacycleorganic 1,3-dipolar compoundcarboxamide grouppyrrolineorganic oxygen compoundhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compound1,3-dicarbonyl compoundcyclic carboximidic acidorganooxygen compound |
|---|
