| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:04:01 UTC |
|---|
| Update Date | 2025-03-21 18:28:25 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00071763 |
|---|
| Frequency | 41.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H9O8P |
|---|
| Molecular Mass | 264.0035 |
|---|
| SMILES | Cc1c(C(=O)OP(=O)(O)O)cc(O)c(O)c1O |
|---|
| InChI Key | JGALQXFTLGZTCR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenols |
|---|
| Subclass | benzenetriols and derivatives |
|---|
| Direct Parent | pyrogallols and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacyl phosphatesbenzoic acids and derivativesbenzoyl derivativeshydrocarbon derivativesmeta cresolsmonocarboxylic acids and derivativesorganic oxidesorganic phosphoric acids and derivativesorganooxygen compoundsortho cresolspara cresolstoluenes |
|---|
| Substituents | monocyclic benzene moietypyrogallol derivativem-cresolbenzoyl1-hydroxy-2-unsubstituted benzenoidbenzoic acid or derivatives1-hydroxy-4-unsubstituted benzenoidcarboxylic acid derivativearomatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundp-cresolo-cresolhydrocarbon derivativetolueneorganic phosphoric acid derivativeorganooxygen compoundacyl phosphate |
|---|
