| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:04:04 UTC |
|---|
| Update Date | 2025-03-21 18:28:27 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00071898 |
|---|
| Frequency | 41.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H16N2O6S |
|---|
| Molecular Mass | 328.0729 |
|---|
| SMILES | CC(=O)NCCc1c[nH]c2ccc(OCOS(=O)(=O)O)cc12 |
|---|
| InChI Key | LBEKYBJMAASHAP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | indoles and derivatives |
|---|
| Subclass | indoles |
|---|
| Direct Parent | indoles |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | acetamidesalkyl sulfatesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphenol etherspyrrolessecondary carboxylic acid amidessulfuric acid monoesters |
|---|
| Substituents | phenol ethersulfuric acid monoestercarbonyl groupindolecarboxylic acid derivativeorganic oxidearomatic heteropolycyclic compoundalkyl sulfateorganonitrogen compoundorganopnictogen compoundacetamideorganic sulfuric acid or derivativesazacycleheteroaromatic compoundcarboxamide groupsecondary carboxylic acid amideorganic oxygen compoundpyrrolesulfate-esterhydrocarbon derivativebenzenoidorganic nitrogen compoundsulfuric acid esterorganooxygen compound |
|---|