| Record Information |
|---|
| HMDB Status | predicted |
|---|
| Creation Date | 2024-02-21 00:04:05 UTC |
|---|
| Update Date | 2025-03-21 18:28:27 UTC |
|---|
| HMDB ID | HMDB0138047 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00071937 |
|---|
| Name | 5,7,8-trihydroxy-2-(3,4,5-trihydroxyphenyl)-4H-chromen-4-one |
|---|
| Frequency | 41.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H10O8 |
|---|
| Molecular Mass | 318.0376 |
|---|
| SMILES | O=c1cc(-c2cc(O)c(O)c(O)c2)oc2c(O)c(O)cc(O)c12 |
|---|
| InChI Key | QTRGQLAKOVDWNM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | hydroxyflavonoids |
|---|
| Direct Parent | 8-hydroxyflavonoids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids3'-hydroxyflavonoids4'-hydroxyflavonoids5-hydroxyflavonoids7-hydroxyflavonoidsbenzene and substituted derivativeschromonesflavonoidsheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganooxygen compoundsoxacyclic compoundspyranones and derivativespyrogallols and derivativesvinylogous acids |
|---|
| Substituents | 8-hydroxyflavonoidmonocyclic benzene moiety1-benzopyran1-hydroxy-2-unsubstituted benzenoidorganic oxidechromonearomatic heteropolycyclic compoundpyranoneorganoheterocyclic compoundbenzopyranpyrogallol derivativebenzenetriolheteroaromatic compound5-hydroxyflavonoid1-hydroxy-4-unsubstituted benzenoid3'-hydroxyflavonoidoxacyclevinylogous acidorganic oxygen compoundpyran7-hydroxyflavonoid4'-hydroxyflavonoidphenolhydrocarbon derivativebenzenoidorganooxygen compound |
|---|
