| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:04:05 UTC |
|---|
| Update Date | 2025-03-21 18:28:27 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00071941 |
|---|
| Frequency | 41.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H12O5 |
|---|
| Molecular Mass | 248.0685 |
|---|
| SMILES | Oc1ccc(C(O)c2c(O)cc(O)cc2O)cc1 |
|---|
| InChI Key | AJOICTLMMBAWEL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylmethanes |
|---|
| Direct Parent | diphenylmethanes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsaromatic alcoholshydrocarbon derivativesphloroglucinols and derivativessecondary alcohols |
|---|
| Substituents | aromatic alcoholalcoholdiphenylmethanebenzenetriol1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidphloroglucinol derivativearomatic homomonocyclic compoundorganic oxygen compoundsecondary alcoholphenolhydrocarbon derivativeorganooxygen compound |
|---|