| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:04:10 UTC |
|---|
| Update Date | 2025-03-21 18:28:29 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00072127 |
|---|
| Frequency | 41.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H11O9P |
|---|
| Molecular Mass | 258.0141 |
|---|
| SMILES | O=C1C(O)C(O)C(O)C(OP(=O)(O)O)C1O |
|---|
| InChI Key | QZSMRYSOQWNODC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | hexose phosphates |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | cyclic ketonescyclitols and derivativeshydrocarbon derivativesmonoalkyl phosphatesorganic oxidespentose phosphatessecondary alcohols |
|---|
| Substituents | alcoholcarbonyl grouppentose phosphatecyclitol or derivativescyclic ketonecyclic alcoholketoneorganic oxidephosphoric acid estermonoalkyl phosphatesecondary alcoholhexose phosphatealiphatic homomonocyclic compoundhydrocarbon derivativeorganic phosphoric acid derivativealkyl phosphate |
|---|
