| Record Information |
|---|
| HMDB Status | predicted |
|---|
| Creation Date | 2024-02-21 00:04:12 UTC |
|---|
| Update Date | 2025-03-21 18:28:29 UTC |
|---|
| HMDB ID | HMDB0132250 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00072201 |
|---|
| Name | 3,4,5-trihydroxy-6-[(6-methoxy-2-oxo-2H-chromen-7-yl)oxy]oxane-2-carboxylic acid |
|---|
| Frequency | 41.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H16O10 |
|---|
| Molecular Mass | 368.0743 |
|---|
| SMILES | COc1cc2ccc(=O)oc2cc1OC1OC(C(=O)O)C(O)C(O)C1O |
|---|
| InChI Key | UTTLUAQBFYOVMO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | coumarins and derivatives |
|---|
| Subclass | coumarin glycosides |
|---|
| Direct Parent | coumarin glycosides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-benzopyransacetalsalkyl aryl ethersanisolesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsglucuronic acid derivativesheteroaromatic compoundshydrocarbon derivativeslactonesmonocarboxylic acids and derivativesmonosaccharideso-glucuronidesorganic oxidesoxacyclic compoundsoxanespyran carboxylic acidspyranones and derivativessecondary alcohols |
|---|
| Substituents | coumarin-7-o-glycosidephenol ethercarbonyl groupethercarboxylic acidcoumarin o-glycosideglucuronic acid or derivatives1-benzopyrano-glucuronidemonosaccharidealkyl aryl ethercarboxylic acid derivativepyran carboxylic acidlactone1-o-glucuronidebeta-hydroxy acidsaccharideorganic oxideacetalaromatic heteropolycyclic compoundpyranoneoxaneorganoheterocyclic compoundalcoholbenzopyranpyran carboxylic acid or derivativesheteroaromatic compoundhydroxy acidoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundpyrananisolesecondary alcoholhydrocarbon derivativebenzenoidorganooxygen compound |
|---|