| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:04:14 UTC |
|---|
| Update Date | 2025-03-21 18:28:30 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00072307 |
|---|
| Frequency | 41.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H12N4O3 |
|---|
| Molecular Mass | 236.0909 |
|---|
| SMILES | CC1OC(n2cnc3ncncc32)C(O)C1O |
|---|
| InChI Key | YPTUZTKSLLVEBO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | imidazopyrimidines |
|---|
| Subclass | purines and purine derivatives |
|---|
| Direct Parent | purines and purine derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diolsazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazolesmonosaccharidesn-substituted imidazolesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundspyrimidines and pyrimidine derivativessecondary alcoholstetrahydrofurans |
|---|
| Substituents | alcoholazacycletetrahydrofuranheteroaromatic compoundmonosaccharidepyrimidineoxacyclesaccharideorganic oxygen compoundaromatic heteropolycyclic compoundimidazoleorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativepurineorganic nitrogen compoundorganooxygen compoundazole1,2-dioln-substituted imidazole |
|---|
