| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:04:17 UTC |
|---|
| Update Date | 2025-03-21 18:28:31 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00072392 |
|---|
| Frequency | 41.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H13N3O4 |
|---|
| Molecular Mass | 203.0906 |
|---|
| SMILES | CC(=O)NNC(=O)CCC(N)C(=O)O |
|---|
| InChI Key | QLGCHRJSPWNAKV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | glutamine and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | acetamidesalpha amino acidscarbonyl compoundscarboxylic acidsdiacylhydrazinesfatty acids and conjugateshydrocarbon derivativesmonoalkylaminesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compounds |
|---|
| Substituents | aliphatic acyclic compoundcarboxylic acid hydrazidecarbonyl groupcarboxylic acidglutamine or derivativesfatty aciddiacylhydrazineorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundacetamideorganooxygen compound |
|---|
