| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:04:18 UTC |
|---|
| Update Date | 2025-03-21 18:28:31 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00072432 |
|---|
| Frequency | 41.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H11N3O5 |
|---|
| Molecular Mass | 229.0699 |
|---|
| SMILES | Nc1ccn(C2OC(O)C(CO)O2)c(=O)n1 |
|---|
| InChI Key | NLIVDSZSNPAVHR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazines |
|---|
| Subclass | pyrimidines and pyrimidine derivatives |
|---|
| Direct Parent | pyrimidones |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,3-dioxolanesazacyclic compoundshemiacetalsheteroaromatic compoundshydrocarbon derivativesimidolactamsorganic carbonic acids and derivativesorganic oxidesorganopnictogen compoundsoxacyclic compoundsprimary alcoholsprimary amines |
|---|
| Substituents | alcoholmeta-dioxolanecarbonic acid derivativearomatic heteromonocyclic compoundazacycleheteroaromatic compoundpyrimidoneoxacycleorganic oxideorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhemiacetalhydrocarbon derivativeprimary amineorganic nitrogen compoundprimary alcoholimidolactamamineorganooxygen compound |
|---|
