| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:04:18 UTC |
|---|
| Update Date | 2025-03-21 18:28:32 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00072451 |
|---|
| Frequency | 41.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H19NO3 |
|---|
| Molecular Mass | 285.1365 |
|---|
| SMILES | CN1C2CC(OC(=O)C=Cc3ccccc3)CC1C1OC12 |
|---|
| InChI Key | RYCUEGUEPUUZCW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | cinnamic acids and derivatives |
|---|
| Subclass | cinnamic acids and derivatives |
|---|
| Direct Parent | cinnamic acids and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | amino acids and derivativesazacyclic compoundsbenzene and substituted derivativescarbonyl compoundsdialkyl ethersenoate estersepoxidesfatty acid estershydrocarbon derivativesmonocarboxylic acids and derivativesmorpholinesn-alkylpyrrolidinesorganic oxidesorganopnictogen compoundsoxacyclic compoundspiperidinestrialkylamines |
|---|
| Substituents | fatty acylmonocyclic benzene moietycarbonyl groupetheramino acid or derivativescarboxylic acid derivativedialkyl etheralpha,beta-unsaturated carboxylic estercinnamic acid or derivativesorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundpyrrolidinepiperidinetertiary amineorganoheterocyclic compoundenoate esterazacyclen-alkylpyrrolidinetertiary aliphatic amineoxiraneoxazinaneoxacyclefatty acid estermorpholinemonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid esterhydrocarbon derivativebenzenoidorganic nitrogen compoundamineorganooxygen compound |
|---|
