| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:04:19 UTC |
|---|
| Update Date | 2025-03-21 18:28:32 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00072499 |
|---|
| Frequency | 41.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C4H10NO7P |
|---|
| Molecular Mass | 215.0195 |
|---|
| SMILES | NC(=O)C(O)C(O)COP(=O)(O)O |
|---|
| InChI Key | NMPLXCYYTOIGAX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphoric acids and derivatives |
|---|
| Subclass | phosphate esters |
|---|
| Direct Parent | monoalkyl phosphates |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | 1,2-diolscarbonyl compoundscarboxylic acids and derivativesfatty amideshydrocarbon derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsprimary carboxylic acid amidessecondary alcohols |
|---|
| Substituents | primary carboxylic acid amidealcoholfatty acylaliphatic acyclic compoundcarbonyl groupfatty amidemonosaccharidecarboxamide groupcarboxylic acid derivativesaccharideorganic oxideorganic oxygen compoundmonoalkyl phosphateorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound1,2-diol |
|---|
