| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:04:21 UTC |
|---|
| Update Date | 2025-03-21 18:28:33 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00072557 |
|---|
| Frequency | 72.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H9NO2 |
|---|
| Molecular Mass | 211.0633 |
|---|
| SMILES | Oc1ccc2c(n1)c(O)cc1ccccc12 |
|---|
| InChI Key | DJHOWHRFGSZHKR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | quinolines and derivatives |
|---|
| Subclass | benzoquinolines |
|---|
| Direct Parent | benzoquinolines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids2-halopyridines8-hydroxyquinolinesazacyclic compoundsheteroaromatic compoundshydrocarbon derivativeshydroxypyridinesnaphthols and derivativesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundspolyhalopyridinesquinolones and derivatives |
|---|
| Substituents | quinolone8-hydroxyquinolineazacyclepolyhalopyridineheteroaromatic compoundhydroxypyridine1-hydroxy-2-unsubstituted benzenoidbenzoquinolinepyridinenaphthaleneorganic oxygen compoundaromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativebenzenoid2-halopyridineorganic nitrogen compound2-naphtholorganooxygen compound |
|---|
