| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:04:22 UTC |
|---|
| Update Date | 2025-03-21 18:28:34 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00072599 |
|---|
| Frequency | 41.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H7NO5 |
|---|
| Molecular Mass | 209.0324 |
|---|
| SMILES | O=C(O)CNC(=O)C1=CC(=O)C(=O)C=C1 |
|---|
| InChI Key | XPFMNYLIJHRMFU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | acyl glycines |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | alpha amino acidscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativeso-benzoquinonesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsquinonessecondary carboxylic acid amides |
|---|
| Substituents | carbonyl groupcarboxylic acido-benzoquinonecyclic ketonecarboxamide groupn-acylglycineketonesecondary carboxylic acid amideorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundorganonitrogen compoundalpha-amino acidaliphatic homomonocyclic compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compoundquinone |
|---|