| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:04:25 UTC |
|---|
| Update Date | 2025-03-21 18:28:34 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00072730 |
|---|
| Frequency | 41.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H16N2O4 |
|---|
| Molecular Mass | 228.111 |
|---|
| SMILES | CC(O)C(O)C1NC(=O)C2CCCN2C1=O |
|---|
| InChI Key | LSTYLMPAISXLRD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acids |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diols2,5-dioxopiperazinesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativeslactamsn-alkylpiperazinesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspyrrolidinessecondary alcoholssecondary carboxylic acid amidestertiary carboxylic acid amides |
|---|
| Substituents | carbonyl grouplactam2,5-dioxopiperazinealiphatic heteropolycyclic compoundorganic oxidedioxopiperazinepiperazinetertiary carboxylic acid amideorganonitrogen compoundalpha-amino acidorganopnictogen compoundpyrrolidineorganoheterocyclic compound1,2-diolalcoholazacyclen-alkylpiperazinecarboxamide groupsecondary carboxylic acid amideorganic oxygen compound1,4-diazinanesecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|