| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-21 00:04:31 UTC |
|---|
| Update Date | 2025-03-21 18:28:36 UTC |
|---|
| HMDB ID | HMDB0257018 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00072978 |
|---|
| Name | Quercetin 3'-O-glucoside |
|---|
| Frequency | 40.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C21H20O12 |
|---|
| Molecular Mass | 464.0955 |
|---|
| SMILES | O=c1c(O)c(-c2ccc(O)c(OC3OC(CO)C(O)C(O)C3O)c2)oc2cc(O)cc(O)c12 |
|---|
| InChI Key | YLWQTYZKYGNKPI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | flavonoid glycosides |
|---|
| Direct Parent | flavonoid o-glycosides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids3-hydroxyflavonoids4'-hydroxyflavonoids5-hydroxyflavonoids7-hydroxyflavonoidsacetalschromonesflavonoidsflavonolsheteroaromatic compoundshydrocarbon derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanesphenol ethersphenoxy compoundsprimary alcoholspyranones and derivativessecondary alcoholsvinylogous acids |
|---|
| Substituents | 3-hydroxyflavonephenol ethermonocyclic benzene moiety3-hydroxyflavonoid1-benzopyran1-hydroxy-2-unsubstituted benzenoidmonosaccharidesaccharideorganic oxideacetalchromonearomatic heteropolycyclic compoundpyranoneflavonoid-3p-o-glycosideoxaneprimary alcoholorganoheterocyclic compoundalcoholbenzopyranheteroaromatic compound5-hydroxyflavonoid1-hydroxy-4-unsubstituted benzenoidflavonoid o-glycosideoxacyclevinylogous acidorganic oxygen compoundpyran7-hydroxyflavonoidsecondary alcohol4'-hydroxyflavonoidphenolhydrocarbon derivativebenzenoidphenoxy compoundorganooxygen compound |
|---|