| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:04:32 UTC |
|---|
| Update Date | 2025-03-21 18:28:37 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00073040 |
|---|
| Frequency | 40.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H8O5S |
|---|
| Molecular Mass | 216.0092 |
|---|
| SMILES | O=S(=O)(O)Oc1ccc2c(c1)OCC2 |
|---|
| InChI Key | AGWUGDIHPQDIQY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | arylsulfates |
|---|
| Direct Parent | arylsulfates |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersbenzenoidscoumaranshydrocarbon derivativesorganic oxidesoxacyclic compoundssulfuric acid monoesters |
|---|
| Substituents | sulfuric acid monoesteretheralkyl aryl etheroxacycleorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundsulfate-esterhydrocarbon derivativearylsulfatebenzenoidsulfuric acid esterorganoheterocyclic compoundcoumaranorganooxygen compound |
|---|
