| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-21 00:04:33 UTC |
|---|
| Update Date | 2025-03-21 18:28:37 UTC |
|---|
| HMDB ID | HMDB0040924 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00073079 |
|---|
| Name | 2-Carboxyarabinitol 5-phosphate |
|---|
| Frequency | 40.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H13O10P |
|---|
| Molecular Mass | 276.0246 |
|---|
| SMILES | O=C(O)C(O)(CO)C(O)C(O)COP(=O)(O)O |
|---|
| InChI Key | FCQQRWFREZXSMK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | pentose phosphates |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha hydroxy acids and derivativesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsfatty acids and conjugateshydrocarbon derivativesmonoalkyl phosphatesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidessecondary alcoholsshort-chain hydroxy acids and derivativestertiary alcohols |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acidshort-chain hydroxy acidpentose phosphatealpha-hydroxy acidfatty acidcarboxylic acid derivativebeta-hydroxy acidorganic oxidealcoholhydroxy acidtertiary alcoholmonocarboxylic acid or derivativesphosphoric acid estermonoalkyl phosphatesecondary alcoholhydrocarbon derivativeorganic phosphoric acid derivativealkyl phosphate |
|---|
