| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:04:35 UTC |
|---|
| Update Date | 2025-03-21 18:28:38 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00073163 |
|---|
| Frequency | 40.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H18N2O4 |
|---|
| Molecular Mass | 278.1267 |
|---|
| SMILES | OC1C(O)C(O)C(NCc2c[nH]c3ccccc23)C1O |
|---|
| InChI Key | FCNMXKDUHGSNKG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | indoles and derivatives |
|---|
| Subclass | indoles |
|---|
| Direct Parent | indoles |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsbenzenoidscyclitols and derivativescyclopentanolsdialkylaminesheteroaromatic compoundshydrocarbon derivativesorganopnictogen compoundspyrroles |
|---|
| Substituents | alcoholsecondary aliphatic amineazacycleindoleheteroaromatic compoundcyclitol or derivativescyclic alcoholsecondary aminecyclopentanolorganic oxygen compoundaromatic heteropolycyclic compoundpyrroleorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compoundamine |
|---|
