| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:04:39 UTC |
|---|
| Update Date | 2025-03-21 18:28:39 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00073300 |
|---|
| Frequency | 40.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H14O9S |
|---|
| Molecular Mass | 274.0359 |
|---|
| SMILES | COC1C(O)C(O)C(O)C(OS(=O)(=O)O)C1O |
|---|
| InChI Key | CBYLXFOZUNHUAE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | cyclohexanols |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl sulfatescyclitols and derivativesdialkyl ethershydrocarbon derivativesorganic oxidessulfuric acid monoesters |
|---|
| Substituents | sulfuric acid monoesteretherorganic sulfuric acid or derivativescyclohexanolcyclitol or derivativescyclic alcoholdialkyl etherorganic oxidealkyl sulfatealiphatic homomonocyclic compoundsulfate-esterhydrocarbon derivativesulfuric acid ester |
|---|
