| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:04:39 UTC |
|---|
| Update Date | 2025-03-21 18:28:40 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00073311 |
|---|
| Frequency | 40.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H21NO4 |
|---|
| Molecular Mass | 315.1471 |
|---|
| SMILES | COc1cc2c(cc1O)C(Cc1cc(O)cc(O)c1)N(C)CC2 |
|---|
| InChI Key | NDNZFBACVRYNLI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | isoquinolines and derivatives |
|---|
| Subclass | benzylisoquinolines |
|---|
| Direct Parent | benzylisoquinolines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsalkyl aryl ethersanisolesaralkylaminesazacyclic compoundsbenzene and substituted derivativeshydrocarbon derivativesorganopnictogen compoundsresorcinolstetrahydroisoquinolinestrialkylamines |
|---|
| Substituents | phenol ethermonocyclic benzene moietyether1-hydroxy-2-unsubstituted benzenoidalkyl aryl etheraralkylamineresorcinolaromatic heteropolycyclic compoundorganonitrogen compoundtetrahydroisoquinolineorganopnictogen compoundtertiary amineazacycletertiary aliphatic amine1-hydroxy-4-unsubstituted benzenoidbenzylisoquinolineorganic oxygen compoundanisolephenolhydrocarbon derivativebenzenoidorganic nitrogen compoundamineorganooxygen compound |
|---|