| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:04:39 UTC |
|---|
| Update Date | 2025-03-21 18:28:40 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00073319 |
|---|
| Frequency | 40.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H8O8S |
|---|
| Molecular Mass | 263.994 |
|---|
| SMILES | O=Cc1c(COS(=O)(=O)O)cc(O)c(O)c1O |
|---|
| InChI Key | OQGAEZURTMSKRX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenols |
|---|
| Subclass | benzenetriols and derivatives |
|---|
| Direct Parent | pyrogallols and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsalkyl sulfatesbenzoyl derivativeshydrocarbon derivativeshydroxybenzaldehydesorganic oxidesorganooxygen compoundssulfuric acid monoestersvinylogous acids |
|---|
| Substituents | monocyclic benzene moietysulfuric acid monoesterorganic sulfuric acid or derivativespyrogallol derivativebenzoyl1-hydroxy-2-unsubstituted benzenoidaldehyde1-hydroxy-4-unsubstituted benzenoidaromatic homomonocyclic compoundvinylogous acidbenzaldehydeorganic oxidearyl-aldehydeorganic oxygen compoundalkyl sulfatesulfate-esterhydrocarbon derivativesulfuric acid esterhydroxybenzaldehydeorganooxygen compound |
|---|
