| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-21 00:04:42 UTC |
|---|
| Update Date | 2025-03-21 18:28:41 UTC |
|---|
| HMDB ID | HMDB0041670 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00073431 |
|---|
| Name | 4',7-Dihydroxy-6-methoxyisoflavan |
|---|
| Frequency | 40.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H16O4 |
|---|
| Molecular Mass | 272.1049 |
|---|
| SMILES | COc1cc2c(cc1O)OCC(c1ccc(O)cc1)C2 |
|---|
| InChI Key | UIGOOLXQMJUBBW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | isoflavonoids |
|---|
| Subclass | o-methylated isoflavonoids |
|---|
| Direct Parent | 6-o-methylated isoflavonoids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-benzopyrans1-hydroxy-2-unsubstituted benzenoidsalkyl aryl ethersanisolesbenzene and substituted derivativeshydrocarbon derivativesisoflavanolsoxacyclic compounds |
|---|
| Substituents | isoflavanphenol ethermonocyclic benzene moietyetherbenzopyran1-benzopyranisoflavanol1-hydroxy-2-unsubstituted benzenoidalkyl aryl etheroxacycle6-methoxyisoflavonoid-skeletonorganic oxygen compoundaromatic heteropolycyclic compoundanisolechromanephenolhydrocarbon derivativebenzenoidorganoheterocyclic compoundorganooxygen compound |
|---|