| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:04:43 UTC |
|---|
| Update Date | 2025-03-21 18:28:41 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00073465 |
|---|
| Frequency | 40.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H17NO8 |
|---|
| Molecular Mass | 339.0954 |
|---|
| SMILES | O=C(O)CCC(NC(OC(=O)Cc1ccccc1)C(=O)O)C(=O)O |
|---|
| InChI Key | ZWWZMVAFVAUIEH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | glutamic acid and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alpha amino acidsamino acidsbenzene and substituted derivativescarbonyl compoundscarboxylic acid esterscarboxylic acidsdialkylamineshydrocarbon derivativesorganic oxidesorganopnictogen compoundstetracarboxylic acids and derivatives |
|---|
| Substituents | secondary aliphatic aminemonocyclic benzene moietycarbonyl groupcarboxylic acidamino acidtetracarboxylic acid or derivativesglutamic acid or derivativessecondary aminearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundcarboxylic acid esterorganonitrogen compoundalpha-amino acidorganopnictogen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compoundamine |
|---|
