| Record Information |
|---|
| HMDB Status | predicted |
|---|
| Creation Date | 2024-02-21 00:04:43 UTC |
|---|
| Update Date | 2025-03-21 18:28:41 UTC |
|---|
| HMDB ID | HMDB0131756 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00073466 |
|---|
| Name | 2-(2,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-1-benzopyran-4-one |
|---|
| Frequency | 40.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H12O7 |
|---|
| Molecular Mass | 304.0583 |
|---|
| SMILES | O=C1c2c(O)cc(O)cc2OC(c2ccc(O)cc2O)C1O |
|---|
| InChI Key | QIWOFDHUQPJCJF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | flavans |
|---|
| Direct Parent | flavanonols |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids3-hydroxyflavonoids4'-hydroxyflavonoids5-hydroxyflavonoids7-hydroxyflavonoidsalkyl aryl ethersaryl alkyl ketonesbenzene and substituted derivativeschromoneshydrocarbon derivativesorganic oxidesoxacyclic compoundsresorcinolssecondary alcoholsvinylogous acids |
|---|
| Substituents | monocyclic benzene moiety3-hydroxyflavonoidetheraryl alkyl ketone1-benzopyran1-hydroxy-2-unsubstituted benzenoidalkyl aryl etherresorcinolketoneorganic oxidechromonearomatic heteropolycyclic compoundchromaneorganoheterocyclic compoundalcoholbenzopyran5-hydroxyflavonoidflavanonol1-hydroxy-4-unsubstituted benzenoidoxacyclevinylogous acidorganic oxygen compound7-hydroxyflavonoidsecondary alcohol4'-hydroxyflavonoidphenolhydrocarbon derivativebenzenoidorganooxygen compoundaryl ketone |
|---|