| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:04:43 UTC |
|---|
| Update Date | 2025-03-21 18:28:41 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00073474 |
|---|
| Frequency | 40.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H19NO5 |
|---|
| Molecular Mass | 293.1263 |
|---|
| SMILES | COC(=O)C(Cc1ccccc1)NC(=O)OC1CCOC1 |
|---|
| InChI Key | UBRXQCIXHYOARB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | phenylalanine and derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alpha amino acid estersalpha amino acidsamphetamines and derivativesbenzene and substituted derivativescarbamate esterscarbonyl compoundsdialkyl ethersfatty acid estershydrocarbon derivativesmethyl estersmonocarboxylic acids and derivativesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundstetrahydrofurans |
|---|
| Substituents | fatty acylmonocyclic benzene moietycarbonyl groupetheraromatic heteromonocyclic compounddialkyl etherorganic oxidemethyl esterorganonitrogen compoundalpha-amino acidorganopnictogen compoundorganoheterocyclic compoundamphetamine or derivativescarbonic acid derivativealpha-amino acid estertetrahydrofurancarbamic acid esteroxacyclefatty acid estermonocarboxylic acid or derivativesphenylalanine or derivativesorganic oxygen compoundcarboxylic acid esterhydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
|---|
