| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:04:43 UTC |
|---|
| Update Date | 2025-03-21 18:28:41 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00073485 |
|---|
| Frequency | 40.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H20N2O |
|---|
| Molecular Mass | 232.1576 |
|---|
| SMILES | CC(C)CC1N=C(O)C(Cc2ccccc2)N1 |
|---|
| InChI Key | NIIDJSLTVXDYHE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzene and substituted derivatives |
|---|
| Direct Parent | benzene and substituted derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscyclic carboximidic acidsdialkylamineshydrocarbon derivativesimidazolinesorganooxygen compoundsorganopnictogen compoundspropargyl-type 1,3-dipolar organic compounds |
|---|
| Substituents | secondary aliphatic aminemonocyclic benzene moietyaromatic heteromonocyclic compoundazacycleorganic 1,3-dipolar compoundsecondary aminepropargyl-type 1,3-dipolar organic compoundorganic oxygen compoundimidazolineorganonitrogen compoundorganopnictogen compound3-imidazolinehydrocarbon derivativeorganic nitrogen compoundcyclic carboximidic acidorganoheterocyclic compoundorganooxygen compoundamine |
|---|
