| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:04:45 UTC |
|---|
| Update Date | 2025-03-21 18:28:42 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00073556 |
|---|
| Frequency | 40.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H9O7P |
|---|
| Molecular Mass | 260.0086 |
|---|
| SMILES | O=C(C=Cc1ccc(O)c(O)c1)OP(=O)(O)O |
|---|
| InChI Key | XPAAKRDMSBEIJL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | cinnamic acids and derivatives |
|---|
| Subclass | hydroxycinnamic acids and derivatives |
|---|
| Direct Parent | hydroxycinnamic acids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacyl monophosphatesbenzene and substituted derivativescarbonyl compoundshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganic phosphoric acids and derivatives |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupacyl monophosphate1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidcarboxylic acid derivativehydroxycinnamic acidaromatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundphenolhydrocarbon derivativebenzenoidorganic phosphoric acid derivativeorganooxygen compoundacyl phosphate |
|---|
