| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:04:46 UTC |
|---|
| Update Date | 2025-03-21 18:28:43 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00073611 |
|---|
| Frequency | 62.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H9O7+ |
|---|
| Molecular Mass | 277.0343 |
|---|
| SMILES | Oc1cc(O)c2oc(-c3cc(O)c(O)c(O)c3)[o+]c2c1 |
|---|
| InChI Key | NHUKKGVFGOPFHX-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenols |
|---|
| Subclass | benzenetriols and derivatives |
|---|
| Direct Parent | pyrogallols and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsbenzene and substituted derivativesheteroaromatic compoundshydrocarbon derivativesorganic cationsorganooxygen compoundsoxacyclic compounds |
|---|
| Substituents | monocyclic benzene moietypyrogallol derivativeheteroaromatic compound1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidoxacycleorganic oxygen compoundaromatic heteropolycyclic compoundhydrocarbon derivativeorganic cationorganoheterocyclic compoundorganooxygen compound |
|---|
