| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:04:47 UTC |
|---|
| Update Date | 2025-03-21 18:28:43 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00073626 |
|---|
| Frequency | 40.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H14O4 |
|---|
| Molecular Mass | 270.0892 |
|---|
| SMILES | O=C1c2ccc(O)cc2OCC1Cc1cccc(O)c1 |
|---|
| InChI Key | HVVIHCDAFHIUNR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | homoisoflavonoids |
|---|
| Subclass | homoisoflavans |
|---|
| Direct Parent | homoisoflavanones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsalkyl aryl ethersaryl alkyl ketonesbenzene and substituted derivativeschromoneshydrocarbon derivativesisoflavanonesisoflavonoidsorganic oxidesoxacyclic compounds |
|---|
| Substituents | monocyclic benzene moietyetheraryl alkyl ketone1-benzopyran1-hydroxy-2-unsubstituted benzenoidalkyl aryl etherisoflavanoneketoneorganic oxidechromonearomatic heteropolycyclic compoundisoflavonoidchromaneorganoheterocyclic compoundbenzopyran1-hydroxy-4-unsubstituted benzenoidoxacycleorganic oxygen compoundphenolhomoisoflavanonehydrocarbon derivativebenzenoidorganooxygen compoundaryl ketone |
|---|