| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:04:49 UTC |
|---|
| Update Date | 2025-03-21 18:28:44 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00073717 |
|---|
| Frequency | 40.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C5H10O8S |
|---|
| Molecular Mass | 230.0096 |
|---|
| SMILES | O=CC(O)C(OS(=O)(=O)O)C(O)CO |
|---|
| InChI Key | WPNDTOYBGQADII-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | sulfuric acid esters |
|---|
| Direct Parent | sulfuric acid monoesters |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alkyl sulfatesalpha-hydroxyaldehydeshydrocarbon derivativesmonosaccharidesorganic oxidesprimary alcoholssecondary alcohols |
|---|
| Substituents | alcoholaliphatic acyclic compoundsulfuric acid monoestercarbonyl groupmonosaccharidealdehydesaccharideorganic oxidealpha-hydroxyaldehydeorganic oxygen compoundalkyl sulfatesecondary alcoholsulfate-esterhydrocarbon derivativeprimary alcoholorganooxygen compound |
|---|