| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:04:49 UTC |
|---|
| Update Date | 2025-03-21 18:28:44 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00073724 |
|---|
| Frequency | 40.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H17ClN2O2 |
|---|
| Molecular Mass | 316.0979 |
|---|
| SMILES | O=C(c1cccnc1)N1CCC(O)(c2ccc(Cl)cc2)CC1 |
|---|
| InChI Key | UWAJSUOQNSIZEZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | piperidines |
|---|
| Subclass | phenylpiperidines |
|---|
| Direct Parent | phenylpiperidines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | aryl chloridesazacyclic compoundscarboxylic acids and derivativeschlorobenzenesheteroaromatic compoundshydrocarbon derivativeshydroxypyridinesn-acylpiperidinesorganic oxidesorganochloridesorganonitrogen compoundsorganopnictogen compoundspyridinecarboxylic acids and derivativestertiary alcoholstertiary carboxylic acid amides |
|---|
| Substituents | pyridine carboxylic acid or derivativesmonocyclic benzene moietyaromatic heteromonocyclic compoundorganochloridecarboxylic acid derivativeorganohalogen compoundorganic oxidetertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compoundaryl chloridechlorobenzenealcoholazacycleheteroaromatic compoundhydroxypyridinecarboxamide grouparyl haliden-acyl-piperidinetertiary alcoholpyridineorganic oxygen compoundphenylpiperidinehydrocarbon derivativebenzenoidorganic nitrogen compoundhalobenzeneorganooxygen compound |
|---|
