| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:04:53 UTC |
|---|
| Update Date | 2025-03-21 18:28:46 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00073872 |
|---|
| Frequency | 40.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H12O4 |
|---|
| Molecular Mass | 244.0736 |
|---|
| SMILES | Oc1cc(O)c2c(c1)CCc1cc(O)cc(O)c1-2 |
|---|
| InChI Key | WCYJPARPHOBONH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenanthrenes and derivatives |
|---|
| Subclass | phenanthrenes and derivatives |
|---|
| Direct Parent | phenanthrenes and derivatives |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidshydrocarbon derivativesnaphthalenesorganooxygen compounds |
|---|
| Substituents | phenanthrenenaphthaleneorganic oxygen compound1-hydroxy-2-unsubstituted benzenoidaromatic homopolycyclic compoundhydrocarbon derivative1-hydroxy-4-unsubstituted benzenoidorganooxygen compound |
|---|