| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:04:53 UTC |
|---|
| Update Date | 2025-03-21 18:28:46 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00073893 |
|---|
| Frequency | 40.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H11N3O2 |
|---|
| Molecular Mass | 169.0851 |
|---|
| SMILES | CN(C)Cc1c[nH]c(=O)[nH]c1=O |
|---|
| InChI Key | QMMQQQNUWGYSAJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazines |
|---|
| Subclass | pyrimidines and pyrimidine derivatives |
|---|
| Direct Parent | pyrimidones |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | aralkylaminesazacyclic compoundsheteroaromatic compoundshydrocarbon derivativeslactamsorganic carbonic acids and derivativesorganic oxidesorganooxygen compoundsorganopnictogen compoundstrialkylaminesvinylogous amides |
|---|
| Substituents | vinylogous amidecarbonic acid derivativelactamaromatic heteromonocyclic compoundazacycleheteroaromatic compoundtertiary aliphatic aminepyrimidonearalkylamineorganic oxideorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundaminetertiary amineorganooxygen compound |
|---|
