| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:04:55 UTC |
|---|
| Update Date | 2025-03-21 18:28:46 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00073963 |
|---|
| Frequency | 40.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C29H34N2O3 |
|---|
| Molecular Mass | 458.2569 |
|---|
| SMILES | NC(=O)c1ccc(C(O)CCCN2CCC(C(O)(c3ccccc3)c3ccccc3)CC2)cc1 |
|---|
| InChI Key | CPLXMJQXRSFVNS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylmethanes |
|---|
| Direct Parent | diphenylmethanes |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | amino acids and derivativesaromatic alcoholsazacyclic compoundsbenzamidesbenzoyl derivativescarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganopnictogen compoundsphenylbutylaminespiperidinesprimary carboxylic acid amidessecondary alcoholstertiary alcoholstrialkylamines |
|---|
| Substituents | aromatic alcoholprimary carboxylic acid amidediphenylmethanearomatic heteromonocyclic compoundamino acid or derivativesbenzoylcarboxylic acid derivativebenzamideorganic oxidephenylbutylamineorganonitrogen compoundorganopnictogen compoundpiperidinetertiary amineorganoheterocyclic compoundalcoholazacycletertiary aliphatic aminebenzoic acid or derivativescarboxamide grouptertiary alcoholorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundamineorganooxygen compound |
|---|
