| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:04:56 UTC |
|---|
| Update Date | 2025-03-21 18:28:47 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00074004 |
|---|
| Frequency | 40.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H20N2O7 |
|---|
| Molecular Mass | 364.1271 |
|---|
| SMILES | O=C(O)CCC(NC(=O)c1ccc(NCC2CCC(=O)O2)cc1)C(=O)O |
|---|
| InChI Key | QQIPCXMZNMBNJS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | glutamic acid and derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alpha amino acidsamino acidsbenzoyl derivativescarbonyl compoundscarboxylic acid esterscarboxylic acidsdelta amino acids and derivativesgamma butyrolactoneshippuric acids and derivativeshydrocarbon derivativesn-acyl-alpha amino acidsorganic oxidesorganopnictogen compoundsoxacyclic compoundsphenylalkylaminessecondary alkylarylaminessecondary carboxylic acid amidestetrahydrofuranstricarboxylic acids and derivatives |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupcarboxylic acidaromatic heteromonocyclic compoundamino acidbenzoyltricarboxylic acid or derivativesbenzamidelactoneorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compounddelta amino acid or derivativesorganoheterocyclic compoundn-acyl-alpha amino acid or derivativesn-acyl-alpha-amino acidtetrahydrofuranhippuric acid or derivativesbenzoic acid or derivativesglutamic acid or derivativessecondary aminecarboxamide groupgamma butyrolactonesecondary aliphatic/aromatic amineoxacyclesecondary carboxylic acid amideorganic oxygen compoundcarboxylic acid esterphenylalkylaminehydrocarbon derivativebenzenoidorganic nitrogen compoundamineorganooxygen compound |
|---|