| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:04:59 UTC |
|---|
| Update Date | 2025-03-21 18:28:48 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00074111 |
|---|
| Frequency | 79.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H10N6 |
|---|
| Molecular Mass | 226.0967 |
|---|
| SMILES | Nc1nc(N)c2nc(-c3ccccc3)[nH]c2n1 |
|---|
| InChI Key | WGJICLLGFIVHNE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | azoles |
|---|
| Subclass | imidazoles |
|---|
| Direct Parent | phenylimidazoles |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsbenzene and substituted derivativesheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsorganopnictogen compoundsprimary aminespurines and purine derivativespyrimidines and pyrimidine derivatives |
|---|
| Substituents | monocyclic benzene moietyazacycleheteroaromatic compoundimidazopyrimidinepyrimidinearomatic heteropolycyclic compound2-phenylimidazoleorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativebenzenoidprimary aminepurineorganic nitrogen compoundimidolactamamine |
|---|
